C21H17ClN2O5 — CID 12808403
4-(2,6-diphenylpyran-4-ylidene)-3-methylpyrazol-1-ium perchlorate (PubChem CID 12808403) has the molecular formula C21H17ClN2O5 and a molecular weight of 412.83 g/mol. Its IUPAC name is 4-(2,6-diphenylpyran-4-ylidene)-3-methylpyrazol-1-ium perchlorate.
| Compound Name | 4-(2,6-diphenylpyran-4-ylidene)-3-methylpyrazol-1-ium perchlorate |
|---|---|
| PubChem CID | 12808403 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-(2,6-diphenylpyran-4-ylidene)-3-methylpyrazol-1-ium perchlorate |
| SMILES | CC1=N[NH+]=CC1=C1C=C(c2ccccc2)OC(c2ccccc2)=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H16N2O.ClHO4/c1-15-19(14-22-23-15)18-12-20(16-8-4-2-5-9-16)24-21(13-18)17-10-6-3-7-11-17;2-1(3,4)5/h2-14H,1H3;(H,2,3,4,5) |
| InChIKey | SOLYRBWUBMJYJC-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |