C23H21ClN2O5 — CID 12808405
4-(2,6-diphenylpyran-4-ylidene)-1,3,5-trimethylpyrazol-1-ium perchlorate (PubChem CID 12808405) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is 4-(2,6-diphenylpyran-4-ylidene)-1,3,5-trimethylpyrazol-1-ium perchlorate.
| Compound Name | 4-(2,6-diphenylpyran-4-ylidene)-1,3,5-trimethylpyrazol-1-ium perchlorate |
|---|---|
| PubChem CID | 12808405 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 4-(2,6-diphenylpyran-4-ylidene)-1,3,5-trimethylpyrazol-1-ium perchlorate |
| SMILES | CC1=N[N+](C)=C(C)C1=C1C=C(c2ccccc2)OC(c2ccccc2)=C1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H21N2O.ClHO4/c1-16-23(17(2)25(3)24-16)20-14-21(18-10-6-4-7-11-18)26-22(15-20)19-12-8-5-9-13-19;2-1(3,4)5/h4-15H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XUECUNOYTBKROI-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 116.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|