C24H22N2O4 — CID 1280920
[3-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 1280920) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is [3-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [3-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 1280920 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [3-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccco1)Oc1cccc(/C=N/c2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C24H22N2O4/c27-24(11-10-22-5-2-14-29-22)30-23-4-1-3-19(17-23)18-25-20-6-8-21(9-7-20)26-12-15-28-16-13-26/h1-11,14,17-18H,12-13,15-16H2/b11-10+,25-18+ |
| InChIKey | PRSSAPAOLWFULI-ADTGEPROSA-N |
| XLogP | 4.49 |
| TPSA | 64.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|