C13H14ClNO5S — CID 12836451
1-(4-chloro-5-methoxyhexa-2,3-dienyl)sulfonyl-4-nitrobenzene (PubChem CID 12836451) has the molecular formula C13H14ClNO5S and a molecular weight of 331.78 g/mol. Its IUPAC name is 1-(4-chloro-5-methoxyhexa-2,3-dienyl)sulfonyl-4-nitrobenzene.
| Compound Name | 1-(4-chloro-5-methoxyhexa-2,3-dienyl)sulfonyl-4-nitrobenzene |
|---|---|
| PubChem CID | 12836451 |
| Molecular Formula | C13H14ClNO5S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 1-(4-chloro-5-methoxyhexa-2,3-dienyl)sulfonyl-4-nitrobenzene |
| SMILES | COC(C)C(Cl)=C=CCS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H14ClNO5S/c1-10(20-2)13(14)4-3-9-21(18,19)12-7-5-11(6-8-12)15(16)17/h3,5-8,10H,9H2,1-2H3 |
| InChIKey | KWSOWVZRJKAMDS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|