C19H19NO7S2 — CID 26183351
1-[(2S,3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-nitrobenzene (PubChem CID 26183351) has the molecular formula C19H19NO7S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[(2S,3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-nitrobenzene.
| Compound Name | 1-[(2S,3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-nitrobenzene |
|---|---|
| PubChem CID | 26183351 |
| Molecular Formula | C19H19NO7S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 1-[(2S,3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-nitrobenzene |
| SMILES | CO[C@@H](C)/C(=C/C=C/S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19NO7S2/c1-15(27-2)19(9-6-14-28(23,24)17-7-4-3-5-8-17)29(25,26)18-12-10-16(11-13-18)20(21)22/h3-15H,1-2H3/b14-6+,19-9-/t15-/m0/s1 |
| InChIKey | VCXILYATOBOWIQ-CYYQZKAESA-N |
| XLogP | 3.27 |
| TPSA | 120.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|