C20H22O5S2 — CID 15092082
1-[(3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-methylbenzene (PubChem CID 15092082) has the molecular formula C20H22O5S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-[(3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 15092082 |
| Molecular Formula | C20H22O5S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[(3Z,5E)-6-(benzenesulfonyl)-2-methoxyhexa-3,5-dien-3-yl]sulfonyl-4-methylbenzene |
| SMILES | COC(C)/C(=C/C=C/S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22O5S2/c1-16-11-13-19(14-12-16)27(23,24)20(17(2)25-3)10-7-15-26(21,22)18-8-5-4-6-9-18/h4-15,17H,1-3H3/b15-7+,20-10- |
| InChIKey | RETULQUMNNUZGZ-JRTLMRLOSA-N |
| XLogP | 3.68 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|