C22H27N3O4 — CID 12837731
(Z)-but-2-enedioic acid;17-propyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaene (PubChem CID 12837731) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;17-propyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaene.
| Compound Name | (Z)-but-2-enedioic acid;17-propyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaene |
|---|---|
| PubChem CID | 12837731 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (Z)-but-2-enedioic acid;17-propyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaene |
| SMILES | CCCN1CCN2c3ccccc3Cn3cccc3C2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H23N3.C4H4O4/c1-2-9-19-11-12-21-16-7-4-3-6-15(16)13-20-10-5-8-17(20)18(21)14-19;5-3(6)1-2-4(7)8/h3-8,10,18H,2,9,11-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RPMOLPPSINOUID-BTJKTKAUSA-N |
| XLogP | 2.83 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|