C22H27N3O5 — CID 70575114
(Z)-but-2-enedioic acid;2-(17-methyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaen-5-yl)ethanol (PubChem CID 70575114) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-(17-methyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaen-5-yl)ethanol.
| Compound Name | (Z)-but-2-enedioic acid;2-(17-methyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaen-5-yl)ethanol |
|---|---|
| PubChem CID | 70575114 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(17-methyl-6,14,17-triazatetracyclo[12.4.0.02,6.08,13]octadeca-2,4,8,10,12-pentaen-5-yl)ethanol |
| SMILES | CN1CCN2c3ccccc3Cn3c(CCO)ccc3C2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H23N3O.C4H4O4/c1-19-9-10-20-16-5-3-2-4-14(16)12-21-15(8-11-22)6-7-17(21)18(20)13-19;5-3(6)1-2-4(7)8/h2-7,18,22H,8-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | INSBMNQJMZAYKJ-BTJKTKAUSA-N |
| XLogP | 1.59 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|