C28H30N2O5 — CID 23205906
[2-(4-benzyl-2-phenylpiperazin-1-yl)phenyl]methanol;(E)-but-2-enedioic acid (PubChem CID 23205906) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is [2-(4-benzyl-2-phenylpiperazin-1-yl)phenyl]methanol;(E)-but-2-enedioic acid.
| Compound Name | [2-(4-benzyl-2-phenylpiperazin-1-yl)phenyl]methanol;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 23205906 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [2-(4-benzyl-2-phenylpiperazin-1-yl)phenyl]methanol;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.OCc1ccccc1N1CCN(Cc2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C24H26N2O.C4H4O4/c27-19-22-13-7-8-14-23(22)26-16-15-25(17-20-9-3-1-4-10-20)18-24(26)21-11-5-2-6-12-21;5-3(6)1-2-4(7)8/h1-14,24,27H,15-19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | HYFOSAAZPUVJAQ-WLHGVMLRSA-N |
| XLogP | 3.95 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|