C24H33N3O7 — CID 12841766
2-(2,3-dimethoxyphenyl)-N-[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]ethyl]acetamide (PubChem CID 12841766) has the molecular formula C24H33N3O7 and a molecular weight of 475.54 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-N-[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]ethyl]acetamide.
| Compound Name | 2-(2,3-dimethoxyphenyl)-N-[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 12841766 |
| Molecular Formula | C24H33N3O7 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-N-[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]ethyl]acetamide |
| SMILES | CNC(=O)COc1ccccc1OCC(O)CNCCNC(=O)Cc1cccc(OC)c1OC |
| InChI | InChI=1S/C24H33N3O7/c1-25-23(30)16-34-20-9-5-4-8-19(20)33-15-18(28)14-26-11-12-27-22(29)13-17-7-6-10-21(31-2)24(17)32-3/h4-10,18,26,28H,11-16H2,1-3H3,(H,25,30)(H,27,29) |
| InChIKey | NUUBOHJWVGYCAJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|