C14H21F2NO — CID 128539680
(3,3-difluorocyclobutyl)-(3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl)methanone (PubChem CID 128539680) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-(3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl)methanone.
| Compound Name | (3,3-difluorocyclobutyl)-(3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 128539680 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (3,3-difluorocyclobutyl)-(3,3-dimethyl-2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl)methanone |
| SMILES | CC1(C)CN(C(=O)C2CC(F)(F)C2)C2CCCC21 |
| InChI | InChI=1S/C14H21F2NO/c1-13(2)8-17(11-5-3-4-10(11)13)12(18)9-6-14(15,16)7-9/h9-11H,3-8H2,1-2H3 |
| InChIKey | RTIMIXPXKGEHSH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |