C17H27NO3 — CID 126454718
[(3aS,6aS)-spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-yl]-[(3R)-oxan-3-yl]methanone (PubChem CID 126454718) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [(3aS,6aS)-spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-yl]-[(3R)-oxan-3-yl]methanone.
| Compound Name | [(3aS,6aS)-spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-yl]-[(3R)-oxan-3-yl]methanone |
|---|---|
| PubChem CID | 126454718 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [(3aS,6aS)-spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-yl]-[(3R)-oxan-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCOC1)N1CC2(CCOCC2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C17H27NO3/c19-16(13-3-2-8-21-11-13)18-12-17(6-9-20-10-7-17)14-4-1-5-15(14)18/h13-15H,1-12H2/t13-,14-,15+/m1/s1 |
| InChIKey | PQRIEKJOMPRNGG-KFWWJZLASA-N |
| XLogP | 2.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |