C22H36N2O3 — CID 128676424
(3aS,6aS)-N-(1-oxaspiro[5.5]undecan-4-yl)spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide (PubChem CID 128676424) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is (3aS,6aS)-N-(1-oxaspiro[5.5]undecan-4-yl)spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide.
| Compound Name | (3aS,6aS)-N-(1-oxaspiro[5.5]undecan-4-yl)spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide |
|---|---|
| PubChem CID | 128676424 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | (3aS,6aS)-N-(1-oxaspiro[5.5]undecan-4-yl)spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide |
| SMILES | O=C(NC1CCOC2(CCCCC2)C1)N1CC2(CCOCC2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C22H36N2O3/c25-20(23-17-7-12-27-22(15-17)8-2-1-3-9-22)24-16-21(10-13-26-14-11-21)18-5-4-6-19(18)24/h17-19H,1-16H2,(H,23,25)/t17?,18-,19+/m1/s1 |
| InChIKey | LODSPAMUJNRPJF-CPSIJMPNSA-N |
| XLogP | 3.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |