C21H27FN2O3 — CID 128614510
(3aS,6aS)-N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide (PubChem CID 128614510) has the molecular formula C21H27FN2O3 and a molecular weight of 374.46 g/mol. Its IUPAC name is (3aS,6aS)-N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide.
| Compound Name | (3aS,6aS)-N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide |
|---|---|
| PubChem CID | 128614510 |
| Molecular Formula | C21H27FN2O3 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (3aS,6aS)-N-[(4S)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide |
| SMILES | O=C(N[C@H]1CCOc2c(F)cccc21)N1CC2(CCOCC2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C21H27FN2O3/c22-16-5-1-3-14-17(7-10-27-19(14)16)23-20(25)24-13-21(8-11-26-12-9-21)15-4-2-6-18(15)24/h1,3,5,15,17-18H,2,4,6-13H2,(H,23,25)/t15-,17+,18+/m1/s1 |
| InChIKey | QQVBHWOGXNQAIQ-NJAFHUGGSA-N |
| XLogP | 3.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |