C20H33N7 — CID 1285411
N-(cyclohexylideneamino)-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 1285411) has the molecular formula C20H33N7 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-(cyclohexylideneamino)-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1285411 |
| Molecular Formula | C20H33N7 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | N-(cyclohexylideneamino)-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CN(N=C1CCCCC1)c1nc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C20H33N7/c1-25(24-17-11-5-2-6-12-17)18-21-19(26-13-7-3-8-14-26)23-20(22-18)27-15-9-4-10-16-27/h2-16H2,1H3 |
| InChIKey | AQGLOTPPXRUSHT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|