C14H18N2O5S2 — CID 128571218
1-(1-benzofuran-7-ylsulfonyl)-N-methylpiperidine-4-sulfonamide (PubChem CID 128571218) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(1-benzofuran-7-ylsulfonyl)-N-methylpiperidine-4-sulfonamide.
| Compound Name | 1-(1-benzofuran-7-ylsulfonyl)-N-methylpiperidine-4-sulfonamide |
|---|---|
| PubChem CID | 128571218 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-(1-benzofuran-7-ylsulfonyl)-N-methylpiperidine-4-sulfonamide |
| SMILES | CNS(=O)(=O)C1CCN(S(=O)(=O)c2cccc3ccoc23)CC1 |
| InChI | InChI=1S/C14H18N2O5S2/c1-15-22(17,18)12-5-8-16(9-6-12)23(19,20)13-4-2-3-11-7-10-21-14(11)13/h2-4,7,10,12,15H,5-6,8-9H2,1H3 |
| InChIKey | IEXYPQYINJKECX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |