C14H16FNO3S — CID 128580754
1-(1-benzofuran-7-ylsulfonyl)-3-fluoro-3-methylpiperidine (PubChem CID 128580754) has the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(1-benzofuran-7-ylsulfonyl)-3-fluoro-3-methylpiperidine.
| Compound Name | 1-(1-benzofuran-7-ylsulfonyl)-3-fluoro-3-methylpiperidine |
|---|---|
| PubChem CID | 128580754 |
| Molecular Formula | C14H16FNO3S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(1-benzofuran-7-ylsulfonyl)-3-fluoro-3-methylpiperidine |
| SMILES | CC1(F)CCCN(S(=O)(=O)c2cccc3ccoc23)C1 |
| InChI | InChI=1S/C14H16FNO3S/c1-14(15)7-3-8-16(10-14)20(17,18)12-5-2-4-11-6-9-19-13(11)12/h2,4-6,9H,3,7-8,10H2,1H3 |
| InChIKey | ITZGYCIXNMSBJJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |