About 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile
4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile (PubChem CID 12857966) has the molecular formula C11H5N3OS
and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile.
Analyze 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile?
The IUPAC name of 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile (CID 12857966) is 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile.
What is the SMILES notation for 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile?
The canonical SMILES for 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile is N#Cc1cnc2sc3ccccc3n2c1=O.
What is the InChIKey of 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile?
The InChIKey is LIMICIDSKSWODS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5N3OS/c12-5-7-6-13-11-14(10(7)15)8-3-1-2-4-9(8)16-11/h1-4,6H.
What are the key properties of 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile?
4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile has a molecular weight of 227.25 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carbonitrile is sourced from PubChem (CID 12857966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).