C11H5N3O2 — CID 12857967
4-oxopyrimido[2,1-b][1,3]benzoxazole-3-carbonitrile (PubChem CID 12857967) has the molecular formula C11H5N3O2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 4-oxopyrimido[2,1-b][1,3]benzoxazole-3-carbonitrile.
| Compound Name | 4-oxopyrimido[2,1-b][1,3]benzoxazole-3-carbonitrile |
|---|---|
| PubChem CID | 12857967 |
| Molecular Formula | C11H5N3O2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 4-oxopyrimido[2,1-b][1,3]benzoxazole-3-carbonitrile |
| SMILES | N#Cc1cnc2oc3ccccc3n2c1=O |
| InChI | InChI=1S/C11H5N3O2/c12-5-7-6-13-11-14(10(7)15)8-3-1-2-4-9(8)16-11/h1-4,6H |
| InChIKey | FPCUAWKVAUQJAT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 71.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |