C14H9N3OSe — CID 162403422
N-phenyl-[1,2,4]selenadiazolo[3,4-b][1,3]benzoxazol-1-imine (PubChem CID 162403422) has the molecular formula C14H9N3OSe and a molecular weight of 314.21 g/mol. Its IUPAC name is N-phenyl-[1,2,4]selenadiazolo[3,4-b][1,3]benzoxazol-1-imine.
| Compound Name | N-phenyl-[1,2,4]selenadiazolo[3,4-b][1,3]benzoxazol-1-imine |
|---|---|
| PubChem CID | 162403422 |
| Molecular Formula | C14H9N3OSe |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | N-phenyl-[1,2,4]selenadiazolo[3,4-b][1,3]benzoxazol-1-imine |
| SMILES | c1ccc(/N=c2\[se]nc3oc4ccccc4n23)cc1 |
| InChI | InChI=1S/C14H9N3OSe/c1-2-6-10(7-3-1)15-14-17-11-8-4-5-9-12(11)18-13(17)16-19-14/h1-9H/b15-14- |
| InChIKey | FTYFTMAVUVTBPV-PFONDFGASA-N |
| XLogP | 2.37 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|