About 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol
1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol (PubChem CID 12857978) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol |
| PubChem CID | 12857978 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol |
| SMILES | OC(Cc1nc(-c2ccccc2)co1)c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c19-16(14-9-5-2-6-10-14)11-17-18-15(12-20-17)13-7-3-1-4-8-13/h1-10,12,16,19H,11H2 |
| InChIKey | KGLZVJHCNVNSKQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol?
The IUPAC name of 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol (CID 12857978) is 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol.
What is the SMILES notation for 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol?
The canonical SMILES for 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol is OC(Cc1nc(-c2ccccc2)co1)c1ccccc1.
What is the InChIKey of 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol?
The InChIKey is KGLZVJHCNVNSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c19-16(14-9-5-2-6-10-14)11-17-18-15(12-20-17)13-7-3-1-4-8-13/h1-10,12,16,19H,11H2.
What are the key properties of 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol?
1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol has a molecular weight of 265.31 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-(4-phenyl-1,3-oxazol-2-yl)ethanol is sourced from PubChem (CID 12857978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).