C14H20ClI — CID 12858527
1,3-ditert-butyl-2-chloro-5-iodobenzene (PubChem CID 12858527) has the molecular formula C14H20ClI and a molecular weight of 350.67 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-chloro-5-iodobenzene.
| Compound Name | 1,3-ditert-butyl-2-chloro-5-iodobenzene |
|---|---|
| PubChem CID | 12858527 |
| Molecular Formula | C14H20ClI |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 1,3-ditert-butyl-2-chloro-5-iodobenzene |
| SMILES | CC(C)(C)c1cc(I)cc(C(C)(C)C)c1Cl |
| InChI | InChI=1S/C14H20ClI/c1-13(2,3)10-7-9(16)8-11(12(10)15)14(4,5)6/h7-8H,1-6H3 |
| InChIKey | JVFCDHGMBOJWHD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|