C15H21N3O10S3 — CID 12866375
7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(sulfosulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 12866375) has the molecular formula C15H21N3O10S3 and a molecular weight of 499.55 g/mol. Its IUPAC name is 7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(sulfosulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(sulfosulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 12866375 |
| Molecular Formula | C15H21N3O10S3 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(sulfosulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC1(NC(=O)CCCC(N)C(=O)O)C(=O)N2C(C(=O)O)=C(CSS(=O)(=O)O)CSC21 |
| InChI | InChI=1S/C15H21N3O10S3/c1-28-15(17-9(19)4-2-3-8(16)11(20)21)13(24)18-10(12(22)23)7(5-29-14(15)18)6-30-31(25,26)27/h8,14H,2-6,16H2,1H3,(H,17,19)(H,20,21)(H,22,23)(H,25,26,27) |
| InChIKey | GBKBBXIMFKWXGE-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 213.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|