C20H31N5O7S2 — CID 22793594
(6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-3-[(N,N'-diethylcarbamimidoyl)sulfanylmethyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22793594) has the molecular formula C20H31N5O7S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is (6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-3-[(N,N'-diethylcarbamimidoyl)sulfanylmethyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-3-[(N,N'-diethylcarbamimidoyl)sulfanylmethyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22793594 |
| Molecular Formula | C20H31N5O7S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-3-[(N,N'-diethylcarbamimidoyl)sulfanylmethyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC/N=C(\NCC)SCC1=C(C(=O)O)N2C(=O)[C@](NC(=O)CCCC(N)C(=O)O)(OC)[C@@H]2SC1 |
| InChI | InChI=1S/C20H31N5O7S2/c1-4-22-19(23-5-2)34-10-11-9-33-18-20(32-3,17(31)25(18)14(11)16(29)30)24-13(26)8-6-7-12(21)15(27)28/h12,18H,4-10,21H2,1-3H3,(H,22,23)(H,24,26)(H,27,28)(H,29,30)/t12?,18-,20-/m0/s1 |
| InChIKey | HFMPQKCEVVRNKQ-UVPYBXRZSA-N |
| XLogP | -0.00 |
| TPSA | 183.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|