C16H20N4O7S2 — CID 22793576
(6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(thiocyanatomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22793576) has the molecular formula C16H20N4O7S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is (6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(thiocyanatomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(thiocyanatomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22793576 |
| Molecular Formula | C16H20N4O7S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (6S,7S)-7-[(5-amino-5-carboxypentanoyl)amino]-7-methoxy-8-oxo-3-(thiocyanatomethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO[C@@]1(NC(=O)CCCC(N)C(=O)O)C(=O)N2C(C(=O)O)=C(CSC#N)CS[C@H]21 |
| InChI | InChI=1S/C16H20N4O7S2/c1-27-16(19-10(21)4-2-3-9(18)12(22)23)14(26)20-11(13(24)25)8(5-28-7-17)6-29-15(16)20/h9,15H,2-6,18H2,1H3,(H,19,21)(H,22,23)(H,24,25)/t9?,15-,16-/m0/s1 |
| InChIKey | AHRFFWBLMAVHSA-OMUNZSLLSA-N |
| XLogP | -0.50 |
| TPSA | 183.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|