C25H29N3O10S — CID 163016503
(6R,7S)-7-[[(5S)-5-amino-5-carboxypentanoyl]amino]-7-methoxy-3-[[(Z)-2-methoxy-3-phenylprop-2-enoyl]oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 163016503) has the molecular formula C25H29N3O10S and a molecular weight of 563.59 g/mol. Its IUPAC name is (6R,7S)-7-[[(5S)-5-amino-5-carboxypentanoyl]amino]-7-methoxy-3-[[(Z)-2-methoxy-3-phenylprop-2-enoyl]oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-[[(5S)-5-amino-5-carboxypentanoyl]amino]-7-methoxy-3-[[(Z)-2-methoxy-3-phenylprop-2-enoyl]oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 163016503 |
| Molecular Formula | C25H29N3O10S |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | (6R,7S)-7-[[(5S)-5-amino-5-carboxypentanoyl]amino]-7-methoxy-3-[[(Z)-2-methoxy-3-phenylprop-2-enoyl]oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/C(=C\c1ccccc1)C(=O)OCC1=C(C(=O)O)N2C(=O)[C@](NC(=O)CCC[C@H](N)C(=O)O)(OC)[C@H]2SC1 |
| InChI | InChI=1S/C25H29N3O10S/c1-36-17(11-14-7-4-3-5-8-14)22(34)38-12-15-13-39-24-25(37-2,23(35)28(24)19(15)21(32)33)27-18(29)10-6-9-16(26)20(30)31/h3-5,7-8,11,16,24H,6,9-10,12-13,26H2,1-2H3,(H,27,29)(H,30,31)(H,32,33)/b17-11-/t16-,24+,25-/m0/s1 |
| InChIKey | YZXBRSYKUQZYNR-SKWFBTEFSA-N |
| XLogP | 0.51 |
| TPSA | 194.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|