About 6-methoxychromenylium
6-methoxychromenylium (PubChem CID 12867628) has the molecular formula C10H9O2+
and a molecular weight of 161.18 g/mol. Its IUPAC name is 6-methoxychromenylium.
Molecular Properties
| Compound Name | 6-methoxychromenylium |
| PubChem CID | 12867628 |
| Molecular Formula | C10H9O2+ |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 6-methoxychromenylium |
| SMILES | COc1ccc2[o+]cccc2c1 |
| InChI | InChI=1S/C10H9O2/c1-11-9-4-5-10-8(7-9)3-2-6-12-10/h2-7H,1H3/q+1 |
| InChIKey | KAFATQJTUHAGLO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxychromenylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxychromenylium?
The IUPAC name of 6-methoxychromenylium (CID 12867628) is 6-methoxychromenylium.
What is the SMILES notation for 6-methoxychromenylium?
The canonical SMILES for 6-methoxychromenylium is COc1ccc2[o+]cccc2c1.
What is the InChIKey of 6-methoxychromenylium?
The InChIKey is KAFATQJTUHAGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O2/c1-11-9-4-5-10-8(7-9)3-2-6-12-10/h2-7H,1H3/q+1.
What are the key properties of 6-methoxychromenylium?
6-methoxychromenylium has a molecular weight of 161.18 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxychromenylium is sourced from PubChem (CID 12867628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).