C17H12ClN3O2S2 — CID 1286805
2-(4-chloro-2-methylphenoxy)-N-(6-isothiocyanato-1,3-benzothiazol-2-yl)acetamide (PubChem CID 1286805) has the molecular formula C17H12ClN3O2S2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-(6-isothiocyanato-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-(6-isothiocyanato-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1286805 |
| Molecular Formula | C17H12ClN3O2S2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-(6-isothiocyanato-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1nc2ccc(N=C=S)cc2s1 |
| InChI | InChI=1S/C17H12ClN3O2S2/c1-10-6-11(18)2-5-14(10)23-8-16(22)21-17-20-13-4-3-12(19-9-24)7-15(13)25-17/h2-7H,8H2,1H3,(H,20,21,22) |
| InChIKey | QOQPZHXBIUGNEW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|