C11H12N4O — CID 12872491
N,N-dimethyl-N'-(5-phenyl-1,2,4-oxadiazol-3-yl)methanimidamide (PubChem CID 12872491) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is N,N-dimethyl-N'-(5-phenyl-1,2,4-oxadiazol-3-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(5-phenyl-1,2,4-oxadiazol-3-yl)methanimidamide |
|---|---|
| PubChem CID | 12872491 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | N,N-dimethyl-N'-(5-phenyl-1,2,4-oxadiazol-3-yl)methanimidamide |
| SMILES | CN(C)/C=N/c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4O/c1-15(2)8-12-11-13-10(16-14-11)9-6-4-3-5-7-9/h3-8H,1-2H3/b12-8+ |
| InChIKey | ONGDYTSHJSDWLH-XYOKQWHBSA-N |
| XLogP | 1.96 |
| TPSA | 54.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|