About 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile
1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile (PubChem CID 12883454) has the molecular formula C13H14N2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile |
| PubChem CID | 12883454 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile |
| SMILES | N#CC1=CN(Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C13H14N2/c14-9-13-7-4-8-15(11-13)10-12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-8,10H2 |
| InChIKey | ZMASGHFMZPQSQI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile?
The IUPAC name of 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile (CID 12883454) is 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile.
What is the SMILES notation for 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile?
The canonical SMILES for 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile is N#CC1=CN(Cc2ccccc2)CCC1.
What is the InChIKey of 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile?
The InChIKey is ZMASGHFMZPQSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2/c14-9-13-7-4-8-15(11-13)10-12-5-2-1-3-6-12/h1-3,5-6,11H,4,7-8,10H2.
What are the key properties of 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile?
1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile has a molecular weight of 198.27 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,4-dihydro-2H-pyridine-5-carbonitrile is sourced from PubChem (CID 12883454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).