C19H31N3O2S — CID 128873847
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-methylazepan-4-amine (PubChem CID 128873847) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-methylazepan-4-amine.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-methylazepan-4-amine |
|---|---|
| PubChem CID | 128873847 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-methylazepan-4-amine |
| SMILES | CC1CCNCCC1NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H31N3O2S/c1-16-7-11-20-12-8-19(16)21-15-17-9-13-22(14-10-17)25(23,24)18-5-3-2-4-6-18/h2-6,16-17,19-21H,7-15H2,1H3 |
| InChIKey | BBOUCJXFQGIHBD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |