C15H26N4 — CID 128875739
(3S)-N-[cyclohexyl(1H-imidazol-2-yl)methyl]piperidin-3-amine (PubChem CID 128875739) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is (3S)-N-[cyclohexyl(1H-imidazol-2-yl)methyl]piperidin-3-amine.
| Compound Name | (3S)-N-[cyclohexyl(1H-imidazol-2-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 128875739 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | (3S)-N-[cyclohexyl(1H-imidazol-2-yl)methyl]piperidin-3-amine |
| SMILES | c1c[nH]c(C(N[C@H]2CCCNC2)C2CCCCC2)n1 |
| InChI | InChI=1S/C15H26N4/c1-2-5-12(6-3-1)14(15-17-9-10-18-15)19-13-7-4-8-16-11-13/h9-10,12-14,16,19H,1-8,11H2,(H,17,18)/t13-,14?/m0/s1 |
| InChIKey | AUDSNYFNCNMTGV-LSLKUGRBSA-N |
| XLogP | 2.37 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |