C11H16N6 — CID 128905079
4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine (PubChem CID 128905079) has the molecular formula C11H16N6 and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine.
| Compound Name | 4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 128905079 |
| Molecular Formula | C11H16N6 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine |
| SMILES | CCn1ncnc1CN1CCCc2[nH]ncc21 |
| InChI | InChI=1S/C11H16N6/c1-2-17-11(12-8-14-17)7-16-5-3-4-9-10(16)6-13-15-9/h6,8H,2-5,7H2,1H3,(H,13,15) |
| InChIKey | YKFJLQAVMKEBMG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |