C19H22N6 — CID 29149412
5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(E)-2-phenylethenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 29149412) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(E)-2-phenylethenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(E)-2-phenylethenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 29149412 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-3-[(E)-2-phenylethenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CCn1ncnc1CN1CCc2[nH]nc(/C=C/c3ccccc3)c2C1 |
| InChI | InChI=1S/C19H22N6/c1-2-25-19(20-14-21-25)13-24-11-10-18-16(12-24)17(22-23-18)9-8-15-6-4-3-5-7-15/h3-9,14H,2,10-13H2,1H3,(H,22,23)/b9-8+ |
| InChIKey | RRHOYYZVJRLDDG-CMDGGOBGSA-N |
| XLogP | 2.75 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |