C18H21ClN6 — CID 31191742
3-[(4-chlorophenyl)methyl]-5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 31191742) has the molecular formula C18H21ClN6 and a molecular weight of 356.86 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-[(4-chlorophenyl)methyl]-5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 31191742 |
| Molecular Formula | C18H21ClN6 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-5-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CCn1ncnc1CN1CCc2[nH]nc(Cc3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C18H21ClN6/c1-2-25-18(20-12-21-25)11-24-8-7-16-15(10-24)17(23-22-16)9-13-3-5-14(19)6-4-13/h3-6,12H,2,7-11H2,1H3,(H,22,23) |
| InChIKey | LVNNMAJAMBADKN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |