C17H20N4O3S — CID 128926926
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propanamide (PubChem CID 128926926) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propanamide |
|---|---|
| PubChem CID | 128926926 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)propanamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)NCc1cn2ccsc2n1 |
| InChI | InChI=1S/C17H20N4O3S/c22-14(18-9-11-10-20-7-8-25-17(20)19-11)5-6-21-15(23)12-3-1-2-4-13(12)16(21)24/h7-8,10,12-13H,1-6,9H2,(H,18,22) |
| InChIKey | HFDKDGXIQRVNDZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|