About 2,2-diphenoxyacetic acid
2,2-diphenoxyacetic acid (PubChem CID 12893) has the molecular formula C14H12O4
and a molecular weight of 244.25 g/mol. Its IUPAC name is 2,2-diphenoxyacetic acid.
Molecular Properties
| Compound Name | 2,2-diphenoxyacetic acid |
| PubChem CID | 12893 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2,2-diphenoxyacetic acid |
| SMILES | O=C(O)C(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C14H12O4/c15-13(16)14(17-11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10,14H,(H,15,16) |
| InChIKey | BWRPEDIXOHZKFD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diphenoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diphenoxyacetic acid?
The IUPAC name of 2,2-diphenoxyacetic acid (CID 12893) is 2,2-diphenoxyacetic acid.
What is the SMILES notation for 2,2-diphenoxyacetic acid?
The canonical SMILES for 2,2-diphenoxyacetic acid is O=C(O)C(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 2,2-diphenoxyacetic acid?
The InChIKey is BWRPEDIXOHZKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4/c15-13(16)14(17-11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10,14H,(H,15,16).
What are the key properties of 2,2-diphenoxyacetic acid?
2,2-diphenoxyacetic acid has a molecular weight of 244.25 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diphenoxyacetic acid is sourced from PubChem (CID 12893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).