C20H31ClN4O2 — CID 128945642
[5-chloro-6-[(3-methyl-2-morpholin-4-ylbutyl)amino]-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 128945642) has the molecular formula C20H31ClN4O2 and a molecular weight of 394.95 g/mol. Its IUPAC name is [5-chloro-6-[(3-methyl-2-morpholin-4-ylbutyl)amino]-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-chloro-6-[(3-methyl-2-morpholin-4-ylbutyl)amino]-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 128945642 |
| Molecular Formula | C20H31ClN4O2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | [5-chloro-6-[(3-methyl-2-morpholin-4-ylbutyl)amino]-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | CC(C)C(CNc1ncc(C(=O)N2CCCCC2)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C20H31ClN4O2/c1-15(2)18(24-8-10-27-11-9-24)14-23-19-17(21)12-16(13-22-19)20(26)25-6-4-3-5-7-25/h12-13,15,18H,3-11,14H2,1-2H3,(H,22,23) |
| InChIKey | WVRKBZZYENDYRC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |