C17H24ClN3O2 — CID 133293714
[5-chloro-6-[(1-methylcyclopentyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 133293714) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is [5-chloro-6-[(1-methylcyclopentyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-chloro-6-[(1-methylcyclopentyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133293714 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [5-chloro-6-[(1-methylcyclopentyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | CC1(CNc2ncc(C(=O)N3CCOCC3)cc2Cl)CCCC1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-17(4-2-3-5-17)12-20-15-14(18)10-13(11-19-15)16(22)21-6-8-23-9-7-21/h10-11H,2-9,12H2,1H3,(H,19,20) |
| InChIKey | AHTQCUARUUUTJI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |