C21H25ClN4O3 — CID 133273421
[5-chloro-6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 133273421) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is [5-chloro-6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-chloro-6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133273421 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [5-chloro-6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc(NCc2ccc(N3CCOCC3)cc2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H25ClN4O3/c22-19-13-17(21(27)26-7-11-29-12-8-26)15-24-20(19)23-14-16-1-3-18(4-2-16)25-5-9-28-10-6-25/h1-4,13,15H,5-12,14H2,(H,23,24) |
| InChIKey | MJYIEZIJFSMXPO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|