C14H19ClN4O4 — CID 126813265
3-[[3-chloro-5-(morpholine-4-carbonyl)-2-pyridinyl]amino]-2-hydroxy-N-methylpropanamide (PubChem CID 126813265) has the molecular formula C14H19ClN4O4 and a molecular weight of 342.78 g/mol. Its IUPAC name is 3-[[3-chloro-5-(morpholine-4-carbonyl)-2-pyridinyl]amino]-2-hydroxy-N-methylpropanamide.
| Compound Name | 3-[[3-chloro-5-(morpholine-4-carbonyl)-2-pyridinyl]amino]-2-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 126813265 |
| Molecular Formula | C14H19ClN4O4 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-[[3-chloro-5-(morpholine-4-carbonyl)-2-pyridinyl]amino]-2-hydroxy-N-methylpropanamide |
| SMILES | CNC(=O)C(O)CNc1ncc(C(=O)N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C14H19ClN4O4/c1-16-13(21)11(20)8-18-12-10(15)6-9(7-17-12)14(22)19-2-4-23-5-3-19/h6-7,11,20H,2-5,8H2,1H3,(H,16,21)(H,17,18) |
| InChIKey | JBYYFWSYTBZQDH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |