C15H15BrClN3O2S — CID 133273341
[6-[(4-bromothiophen-2-yl)methylamino]-5-chloro-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 133273341) has the molecular formula C15H15BrClN3O2S and a molecular weight of 416.73 g/mol. Its IUPAC name is [6-[(4-bromothiophen-2-yl)methylamino]-5-chloro-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [6-[(4-bromothiophen-2-yl)methylamino]-5-chloro-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133273341 |
| Molecular Formula | C15H15BrClN3O2S |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | [6-[(4-bromothiophen-2-yl)methylamino]-5-chloro-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc(NCc2cc(Br)cs2)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C15H15BrClN3O2S/c16-11-6-12(23-9-11)8-19-14-13(17)5-10(7-18-14)15(21)20-1-3-22-4-2-20/h5-7,9H,1-4,8H2,(H,18,19) |
| InChIKey | ZTYNXCJTEGXYAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |