C17H18Cl3N5O2 — CID 133273295
[5-chloro-6-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 133273295) has the molecular formula C17H18Cl3N5O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is [5-chloro-6-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [5-chloro-6-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133273295 |
| Molecular Formula | C17H18Cl3N5O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | [5-chloro-6-[2-[(3,5-dichloro-2-pyridinyl)amino]ethylamino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc(NCCNc2ncc(Cl)cc2Cl)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C17H18Cl3N5O2/c18-12-8-14(20)16(24-10-12)22-2-1-21-15-13(19)7-11(9-23-15)17(26)25-3-5-27-6-4-25/h7-10H,1-6H2,(H,21,23)(H,22,24) |
| InChIKey | PDUPJYDNGPQIEN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|