C10H11BrFN — CID 12896817
5-bromo-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 12896817) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is 5-bromo-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 5-bromo-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 12896817 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 5-bromo-6-fluoro-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCc2c(ccc(F)c2Br)N1 |
| InChI | InChI=1S/C10H11BrFN/c1-6-2-3-7-9(13-6)5-4-8(12)10(7)11/h4-6,13H,2-3H2,1H3 |
| InChIKey | XHAXMUHHFPDPDH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |