C12H17N — CID 130741224
(2S)-5-ethyl-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 130741224) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (2S)-5-ethyl-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S)-5-ethyl-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 130741224 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2S)-5-ethyl-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCc1cccc2c1CC[C@H](C)N2 |
| InChI | InChI=1S/C12H17N/c1-3-10-5-4-6-12-11(10)8-7-9(2)13-12/h4-6,9,13H,3,7-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | RXPONTVNCRYCPB-VIFPVBQESA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |