C14H20N2O4 — CID 128988923
3-hydroxy-1-(2-propan-2-ylfuran-3-carbonyl)piperidine-3-carboxamide (PubChem CID 128988923) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-hydroxy-1-(2-propan-2-ylfuran-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | 3-hydroxy-1-(2-propan-2-ylfuran-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 128988923 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-hydroxy-1-(2-propan-2-ylfuran-3-carbonyl)piperidine-3-carboxamide |
| SMILES | CC(C)c1occc1C(=O)N1CCCC(O)(C(N)=O)C1 |
| InChI | InChI=1S/C14H20N2O4/c1-9(2)11-10(4-7-20-11)12(17)16-6-3-5-14(19,8-16)13(15)18/h4,7,9,19H,3,5-6,8H2,1-2H3,(H2,15,18) |
| InChIKey | JHMJZRUFUUYFFF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |