C17H31N3O4S — CID 129002871
4-[cyclobutyl(methylsulfonyl)amino]-N-(oxolan-3-ylmethyl)azepane-1-carboxamide (PubChem CID 129002871) has the molecular formula C17H31N3O4S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-[cyclobutyl(methylsulfonyl)amino]-N-(oxolan-3-ylmethyl)azepane-1-carboxamide.
| Compound Name | 4-[cyclobutyl(methylsulfonyl)amino]-N-(oxolan-3-ylmethyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 129002871 |
| Molecular Formula | C17H31N3O4S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[cyclobutyl(methylsulfonyl)amino]-N-(oxolan-3-ylmethyl)azepane-1-carboxamide |
| SMILES | CS(=O)(=O)N(C1CCC1)C1CCCN(C(=O)NCC2CCOC2)CC1 |
| InChI | InChI=1S/C17H31N3O4S/c1-25(22,23)20(15-4-2-5-15)16-6-3-9-19(10-7-16)17(21)18-12-14-8-11-24-13-14/h14-16H,2-13H2,1H3,(H,18,21) |
| InChIKey | NXMDHXNSORGRNL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |