C13H16Cl3N7O2 — CID 129009269
N-[(Z)-[amino-[2-(pyridine-3-carbonyl)hydrazinyl]methylidene]amino]pyridine-3-carboxamide;trihydrochloride (PubChem CID 129009269) has the molecular formula C13H16Cl3N7O2 and a molecular weight of 408.68 g/mol. Its IUPAC name is N-[(Z)-[amino-[2-(pyridine-3-carbonyl)hydrazinyl]methylidene]amino]pyridine-3-carboxamide;trihydrochloride.
| Compound Name | N-[(Z)-[amino-[2-(pyridine-3-carbonyl)hydrazinyl]methylidene]amino]pyridine-3-carboxamide;trihydrochloride |
|---|---|
| PubChem CID | 129009269 |
| Molecular Formula | C13H16Cl3N7O2 |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-[(Z)-[amino-[2-(pyridine-3-carbonyl)hydrazinyl]methylidene]amino]pyridine-3-carboxamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.N/C(=N/NC(=O)c1cccnc1)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C13H13N7O2.3ClH/c14-13(19-17-11(21)9-3-1-5-15-7-9)20-18-12(22)10-4-2-6-16-8-10;;;/h1-8H,(H,17,21)(H,18,22)(H3,14,19,20);3*1H |
| InChIKey | UUECOXYPOYZLCE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|