C31H38N6OS — CID 129010726
N-[3-[(2-methylbenzimidazol-1-yl)methyl]cyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 129010726) has the molecular formula C31H38N6OS and a molecular weight of 542.75 g/mol. Its IUPAC name is N-[3-[(2-methylbenzimidazol-1-yl)methyl]cyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[3-[(2-methylbenzimidazol-1-yl)methyl]cyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 129010726 |
| Molecular Formula | C31H38N6OS |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | N-[3-[(2-methylbenzimidazol-1-yl)methyl]cyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C3NNC4CCC(C(=O)NC5CCCC(Cn6c(C)nc7ccccc76)C5)CC43)cc2s1 |
| InChI | InChI=1S/C31H38N6OS/c1-18-32-26-8-3-4-9-28(26)37(18)17-20-6-5-7-23(14-20)34-31(38)22-11-12-25-24(15-22)30(36-35-25)21-10-13-27-29(16-21)39-19(2)33-27/h3-4,8-10,13,16,20,22-25,30,35-36H,5-7,11-12,14-15,17H2,1-2H3,(H,34,38) |
| InChIKey | XYLQXJFIQXOCHY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |