C17H26N4O2 — CID 129012229
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea (PubChem CID 129012229) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 129012229 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea |
| SMILES | O=C(NC1CCC2NNCC2C1)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C17H26N4O2/c22-11-15(8-12-4-2-1-3-5-12)20-17(23)19-14-6-7-16-13(9-14)10-18-21-16/h1-5,13-16,18,21-22H,6-11H2,(H2,19,20,23)/t13?,14?,15-,16?/m1/s1 |
| InChIKey | JZEOMJCWGBOLNT-MYLOQMAZSA-N |
| XLogP | 0.53 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |